Poly(L-lactide-co-caprolactone)
Synonyms: PLCL, PLLA-PCL, Poly(l-lactide-co-ε-caprolactone)
Linear Formula: CH3(C6H10O2)m(C6H8O4)nCH3
Range of Viscolity: 0.2-3.0 dl/g
Specification: L-PLCL/7525,L-PLCL5050
Minimal order quantity: 30 gram
Poly(L-lactide-co-caprolactone), also known as PLLA-PCL or simply PLCL, is a biodegradable copolymer made by combining two different monomers: L-lactide and caprolactone. This copolymer exhibits unique properties due to its composition, making it suitable for various biomedical and pharmaceutical applications.
The “poly” in poly(L-lactide-co-caprolactone) signifies that it’s a polymer, which means it’s composed of repeating units of its constituent monomers. L-lactide and caprolactone are both organic compounds that can be polymerized to create a chain-like structure.
PLLA (Poly-L-lactide) and PCL (Polycaprolactone) are individual polymers with their own distinct characteristics. PLLA is known for its rigidity and high strength, while PCL is known for its flexibility and biocompatibility. When these two polymers are combined in a copolymer like PLCL, you get a material with a balance of properties. PLCL can be tailored to have specific characteristics by adjusting the ratio of L-lactide to caprolactone in the copolymer.
PLCL’s biodegradability and biocompatibility make it valuable in various medical applications, such as drug delivery systems, tissue engineering, and biodegradable sutures. Its ability to degrade over time without causing harm to the body is particularly advantageous in medical settings.
Need Help for Your Project and Look for Professional Idea?
